N-chloro-N-phenyl-benzamide structure
|
Common Name | N-chloro-N-phenyl-benzamide | ||
|---|---|---|---|---|
| CAS Number | 5014-47-1 | Molecular Weight | 231.67800 | |
| Density | 1.274g/cm3 | Boiling Point | 338.1ºC at 760 mmHg | |
| Molecular Formula | C13H10ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.3ºC | |
| Name | N-Chloro-N-phenylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.274g/cm3 |
|---|---|
| Boiling Point | 338.1ºC at 760 mmHg |
| Molecular Formula | C13H10ClNO |
| Molecular Weight | 231.67800 |
| Flash Point | 158.3ºC |
| Exact Mass | 231.04500 |
| PSA | 20.31000 |
| LogP | 3.48720 |
| Index of Refraction | 1.643 |
| InChIKey | CJMAMOWDLBJBKI-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)N(Cl)c1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~54%
N-chloro-N-phen... CAS#:5014-47-1 |
| Literature: Berube, Denis; Lessard, Jean Canadian Journal of Chemistry, 1982 , vol. 60, p. 1127 - 1142 |
| Precursor 1 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Chlor-N-benzoyl-anilin |
| N-Phenyl-N-chlorobenzamide |
| N-Chlor-benzanilid |
| N-chlorobenzanilide |