2-Chloro-7,8-dihydro-7-methyl-8-(3-methylbutyl)-6(5H)-pteridinone structure
|
Common Name | 2-Chloro-7,8-dihydro-7-methyl-8-(3-methylbutyl)-6(5H)-pteridinone | ||
|---|---|---|---|---|
| CAS Number | 501439-14-1 | Molecular Weight | 268.74300 | |
| Density | 1.19 | Boiling Point | 472.9ºC at 760 mmHg | |
| Molecular Formula | C12H17ClN4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.8ºC | |
| Name | 2-chloro-7-methyl-8-(3-methylbutyl)-5,7-dihydropteridin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19 |
|---|---|
| Boiling Point | 472.9ºC at 760 mmHg |
| Molecular Formula | C12H17ClN4O |
| Molecular Weight | 268.74300 |
| Flash Point | 239.8ºC |
| Exact Mass | 268.10900 |
| PSA | 58.12000 |
| LogP | 2.52610 |
| Index of Refraction | 1.53 |
| InChIKey | KYXVYVHEPNXIKE-UHFFFAOYSA-N |
| SMILES | CC(C)CCN1c2nc(Cl)ncc2NC(=O)C1C |
| HS Code | 2933990090 |
|---|
|
~62%
2-Chloro-7,8-di... CAS#:501439-14-1 |
| Literature: WO2013/71217 A1, ; Page/Page column 30-32 ; |
|
~%
2-Chloro-7,8-di... CAS#:501439-14-1 |
| Literature: WO2013/71217 A1, ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| qc-3914 |