2-(5-chloronaphthalene-1-carbonyl)benzoic acid structure
|
Common Name | 2-(5-chloronaphthalene-1-carbonyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 5018-89-3 | Molecular Weight | 310.73100 | |
| Density | 1.374g/cm3 | Boiling Point | 551.6ºC at 760 mmHg | |
| Molecular Formula | C18H11ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.4ºC | |
| Name | 2-(5-chloronaphthalene-1-carbonyl)benzoic acid |
|---|
| Density | 1.374g/cm3 |
|---|---|
| Boiling Point | 551.6ºC at 760 mmHg |
| Molecular Formula | C18H11ClO3 |
| Molecular Weight | 310.73100 |
| Flash Point | 287.4ºC |
| Exact Mass | 310.04000 |
| PSA | 54.37000 |
| LogP | 4.42240 |
| Index of Refraction | 1.682 |
| InChIKey | GBCIAQSKZAMJRO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1C(=O)c1cccc2c(Cl)cccc12 |
| HS Code | 2916399090 |
|---|
|
~%
2-(5-chloronaph... CAS#:5018-89-3 |
| Literature: Johnson; Weinmayr; Adams Journal of the American Chemical Society, 1932 , vol. 54, p. 3289,3294 |
|
~%
2-(5-chloronaph... CAS#:5018-89-3 |
| Literature: Newman; Venkateswaran Journal of medicinal chemistry, 1967 , vol. 10, # 4 p. 728 - 729 |
|
~%
2-(5-chloronaph... CAS#:5018-89-3 |
| Literature: Johnson; Weinmayr; Adams Journal of the American Chemical Society, 1932 , vol. 54, p. 3289,3294 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |