3-methyl-1-benzofuran-5-carboxylic acid structure
|
Common Name | 3-methyl-1-benzofuran-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 501892-99-5 | Molecular Weight | 176.16900 | |
| Density | 1.303g/cm3 | Boiling Point | 346ºC at 760 mmHg | |
| Molecular Formula | C10H8O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163ºC | |
| Name | 3-methyl-1-benzofuran-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.303g/cm3 |
|---|---|
| Boiling Point | 346ºC at 760 mmHg |
| Molecular Formula | C10H8O3 |
| Molecular Weight | 176.16900 |
| Flash Point | 163ºC |
| Exact Mass | 176.04700 |
| PSA | 50.44000 |
| LogP | 2.43940 |
| Index of Refraction | 1.631 |
| InChIKey | ICGCSXAZTJXZAG-UHFFFAOYSA-N |
| SMILES | CC1=COC2=C1C=C(C=C2)C(=O)O |
| HS Code | 2932999099 |
|---|
|
~93%
3-methyl-1-benz... CAS#:501892-99-5 |
| Literature: Walker, Daniel Patrick; Piotrowski, David W.; Jacobsen, Eric Jon; Acker, Brad A.; Groppi JR., Vincent E. Patent: US2003/232853 A1, 2003 ; Location in patent: Page 44 ; |
|
~94%
3-methyl-1-benz... CAS#:501892-99-5 |
| Literature: Wishka, Donn G.; Walker, Daniel Patrick; Corbett, Jeffrey W.; Reitz, Steven Charles; Rauckhorst, Mark R.; Groppi JR., Vincent E. Patent: US2003/105089 A1, 2003 ; US 20030105089 A1 |
|
~%
3-methyl-1-benz... CAS#:501892-99-5 |
| Literature: BIOENERGENIX Patent: US2012/277224 A1, 2012 ; US 20120277224 A1 |
|
~%
3-methyl-1-benz... CAS#:501892-99-5 |
| Literature: BIOENERGENIX Patent: US2012/277224 A1, 2012 ; US 20120277224 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-METHYLBENZOFURAN-5-CARBOXYLIC ACID |
| 5-Benzofurancarboxylicacid,3-methyl |