N-(2-nitrophenyl)pyridin-3-amine structure
|
Common Name | N-(2-nitrophenyl)pyridin-3-amine | ||
|---|---|---|---|---|
| CAS Number | 5024-63-5 | Molecular Weight | 215.20800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2-nitrophenyl)pyridin-3-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H9N3O2 |
|---|---|
| Molecular Weight | 215.20800 |
| Exact Mass | 215.06900 |
| PSA | 70.74000 |
| LogP | 3.32960 |
| InChIKey | SXVSSCAHINUDRC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1Nc1cccnc1 |
| HS Code | 2933399090 |
|---|
|
~76%
N-(2-nitropheny... CAS#:5024-63-5 |
| Literature: Xia, Shuai; Wang, Li-Ying; Sun, Heng-Zhi; Yue, Huan; Wang, Xiu-Hua; Tan, Jia-Lian; Wang, Yin; Hou, Di; He, Xiao-Yan; Mun, Ki-Cheol; Kumar, B. Prem; Zuo, Hua; Shin, Dong-Soo Bulletin of the Korean Chemical Society, 2013 , vol. 34, # 2 p. 394 - 398 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Nitro-N-pyridyl-3-anilin |
| HMS2226A19 |