tert-butyl 4-benzyl-2-ethylpiperazine-1-carboxylate
Modify Date: 2025-09-17 12:09:34
tert-butyl 4-benzyl-2-ethylpiperazine-1-carboxylate structure
|
Common Name | tert-butyl 4-benzyl-2-ethylpiperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 502482-44-2 | Molecular Weight | 304.42700 | |
| Density | 1.043g/cm3 | Boiling Point | 386.5ºC at 760 mmHg | |
| Molecular Formula | C18H28N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.6ºC | |
| Name | tert-butyl 4-benzyl-2-ethylpiperazine-1-carboxylate |
|---|
| Density | 1.043g/cm3 |
|---|---|
| Boiling Point | 386.5ºC at 760 mmHg |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.42700 |
| Flash Point | 187.6ºC |
| Exact Mass | 304.21500 |
| PSA | 32.78000 |
| LogP | 3.39370 |
| Index of Refraction | 1.521 |
| InChIKey | HUXGLBKCRYRMDA-UHFFFAOYSA-N |
| SMILES | CCC1CN(Cc2ccccc2)CCN1C(=O)OC(C)(C)C |
| HS Code | 2933599090 |
|---|
CAS#:325145-35-5| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |