dimethyl [2-(trifluoromethyl)phenyl] phosphate structure
|
Common Name | dimethyl [2-(trifluoromethyl)phenyl] phosphate | ||
|---|---|---|---|---|
| CAS Number | 502623-70-3 | Molecular Weight | 270.14200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10F3O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl [2-(trifluoromethyl)phenyl] phosphate |
|---|
| Molecular Formula | C9H10F3O4P |
|---|---|
| Molecular Weight | 270.14200 |
| Exact Mass | 270.02700 |
| PSA | 54.57000 |
| LogP | 3.48510 |
| InChIKey | AXRBMHGVIIJCHG-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)Oc1ccccc1C(F)(F)F |
|
~50%
dimethyl [2-(tr... CAS#:502623-70-3 |
| Literature: Zhou, Xinming; He, Yantao; Wang, Miao; Ding, Yixiang Phosphorus, Sulfur and Silicon and the Related Elements, 2009 , vol. 184, # 3 p. 651 - 659 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |