1-Boc-3-Propylpiperazine structure
|
Common Name | 1-Boc-3-Propylpiperazine | ||
|---|---|---|---|---|
| CAS Number | 502649-27-6 | Molecular Weight | 228.331 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 303.9±17.0 °C at 760 mmHg | |
| Molecular Formula | C12H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.6±20.9 °C | |
| Name | tert-butyl 3-propylpiperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 303.9±17.0 °C at 760 mmHg |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.331 |
| Flash Point | 137.6±20.9 °C |
| Exact Mass | 228.183777 |
| PSA | 41.57000 |
| LogP | 2.11 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.459 |
| InChIKey | UTQYTJHYWCCQIJ-UHFFFAOYSA-N |
| SMILES | CCCC1CN(C(=O)OC(C)(C)C)CCN1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Propyl-piperazine-1-carboxylic acid tert-butyl ester |
| 1-Boc-3-propyl-piperazine |
| tert-Butyl 3-propylpiperazine-1-carboxylate |