1,3,4-triphenyl-1H-pyrazole-5-acetonitrile
Modify Date: 2025-10-10 11:08:27
1,3,4-triphenyl-1H-pyrazole-5-acetonitrile structure
|
Common Name | 1,3,4-triphenyl-1H-pyrazole-5-acetonitrile | ||
|---|---|---|---|---|
| CAS Number | 50270-55-8 | Molecular Weight | 335.40100 | |
| Density | 1.11g/cm3 | Boiling Point | 517ºC at 760 mmHg | |
| Molecular Formula | C23H17N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.5ºC | |
| Name | 2-(2,4,5-triphenylpyrazol-3-yl)acetonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 517ºC at 760 mmHg |
| Molecular Formula | C23H17N3 |
| Molecular Weight | 335.40100 |
| Flash Point | 266.5ºC |
| Exact Mass | 335.14200 |
| PSA | 41.61000 |
| LogP | 5.27238 |
| Index of Refraction | 1.631 |
| InChIKey | JKISWSOCTWDLSE-UHFFFAOYSA-N |
| SMILES | N#CCc1c(-c2ccccc2)c(-c2ccccc2)nn1-c1ccccc1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 256-513-7 |
| 1,3,4-Triphenyl-5-pyrazolacetonitril |
| 1,3,4-Triphenyl-1H-pyrazole-5-acetonitrile |
| 1,3,4-Triphenylpyrazole-5-acetonitrile |
| 1H-Pyrazole-5-acetonitrile,1,3,4-triphenyl |