3-(5-bromopyridin-3-yl)-1-(2-propan-2-ylphenyl)-4,5,6,7-tetrahydro-2H-pyrazolo[3,4-b]azepine structure
|
Common Name | 3-(5-bromopyridin-3-yl)-1-(2-propan-2-ylphenyl)-4,5,6,7-tetrahydro-2H-pyrazolo[3,4-b]azepine | ||
|---|---|---|---|---|
| CAS Number | 5037-73-0 | Molecular Weight | 411.33800 | |
| Density | 1.4g/cm3 | Boiling Point | 527.3ºC at 760 mmHg | |
| Molecular Formula | C21H23BrN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272.7ºC | |
| Name | 3-(5-bromopyridin-3-yl)-1-(2-propan-2-ylphenyl)-4,5,6,7-tetrahydro-2H-pyrazolo[3,4-b]azepine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 527.3ºC at 760 mmHg |
| Molecular Formula | C21H23BrN4 |
| Molecular Weight | 411.33800 |
| Flash Point | 272.7ºC |
| Exact Mass | 410.11100 |
| PSA | 45.97000 |
| LogP | 4.42590 |
| Index of Refraction | 1.672 |
| InChIKey | OIPVVXLVZLEQQA-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccccc1-n1nc(-c2cncc(Br)c2)c2c1NCCCC2 |
|
~%
3-(5-bromopyrid... CAS#:5037-73-0 |
| Literature: Tarbell; Mallatt; Wilson Journal of the American Chemical Society, 1942 , vol. 64, p. 2229 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,1-Diphenyl-N-phenylcarbamat |