Propanamide, 3-[formyl(5-nitro-2-thiazolyl)amino]- structure
|
Common Name | Propanamide, 3-[formyl(5-nitro-2-thiazolyl)amino]- | ||
|---|---|---|---|---|
| CAS Number | 50384-06-0 | Molecular Weight | 244.22800 | |
| Density | 1.595g/cm3 | Boiling Point | 534ºC at 760mmHg | |
| Molecular Formula | C7H8N4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.8ºC | |
| Name | 3-[formyl-(5-nitro-1,3-thiazol-2-yl)amino]propanamide |
|---|
| Density | 1.595g/cm3 |
|---|---|
| Boiling Point | 534ºC at 760mmHg |
| Molecular Formula | C7H8N4O4S |
| Molecular Weight | 244.22800 |
| Flash Point | 276.8ºC |
| Exact Mass | 244.02700 |
| PSA | 150.35000 |
| LogP | 1.74890 |
| Index of Refraction | 1.661 |
| InChIKey | WOWYCMINZHTTRO-UHFFFAOYSA-N |
| SMILES | NC(=O)CCN(C=O)c1ncc([N+](=O)[O-])s1 |
|
~%
Propanamide, 3-... CAS#:50384-06-0 |
| Literature: Islip,P.J. et al. Journal of Medicinal Chemistry, 1973 , vol. 16, p. 1027 - 1030 |
|
~%
Propanamide, 3-... CAS#:50384-06-0 |
| Literature: Islip,P.J. et al. Journal of Medicinal Chemistry, 1973 , vol. 16, p. 1027 - 1030 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |