Acetamide,N-(4-phenyl-2-thiazolyl)- structure
|
Common Name | Acetamide,N-(4-phenyl-2-thiazolyl)- | ||
|---|---|---|---|---|
| CAS Number | 5039-09-8 | Molecular Weight | 218.27500 | |
| Density | 1.28g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H10N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-p-Tolyl-3-brompropionamid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Molecular Formula | C11H10N2OS |
| Molecular Weight | 218.27500 |
| Exact Mass | 218.05100 |
| PSA | 70.23000 |
| LogP | 2.84150 |
| Index of Refraction | 1.642 |
| InChIKey | HJZGXXPOKWGQHH-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1nc(-c2ccccc2)cs1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-acetamide-4-phenyl-1,3-thiazole |
| 2-acetylamino-4-phenylthiazole |
| 3-Brom-propionsaeure-p-toluidid |