3,4-Dihydro-1-(o-nitrophenyl)-4,4,6-trimethyl-2(1H)-pyrimidinethione structure
|
Common Name | 3,4-Dihydro-1-(o-nitrophenyl)-4,4,6-trimethyl-2(1H)-pyrimidinethione | ||
|---|---|---|---|---|
| CAS Number | 50403-73-1 | Molecular Weight | 277.34200 | |
| Density | 1.31g/cm3 | Boiling Point | 383.3ºC at 760 mmHg | |
| Molecular Formula | C13H15N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.6ºC | |
| Name | 4,6,6-trimethyl-3-(2-nitrophenyl)-1H-pyrimidine-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 383.3ºC at 760 mmHg |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.34200 |
| Flash Point | 185.6ºC |
| Exact Mass | 277.08800 |
| PSA | 100.22000 |
| LogP | 3.40680 |
| Index of Refraction | 1.655 |
| InChIKey | XIZVGHGAGIWVAW-UHFFFAOYSA-N |
| SMILES | CC1=CC(C)(C)NC(=S)N1c1ccccc1[N+](=O)[O-] |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| usaf k-1351 |