phenylsulfanyl-(2,4,6-trimethylphenyl)methanone structure
|
Common Name | phenylsulfanyl-(2,4,6-trimethylphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 50404-53-0 | Molecular Weight | 256.36300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | S-phenyl 2,4,6-trimethylbenzenecarbothioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H16OS |
|---|---|
| Molecular Weight | 256.36300 |
| Exact Mass | 256.09200 |
| PSA | 42.37000 |
| LogP | 4.54430 |
| InChIKey | CONXDVVCZMNSPL-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C(=O)Sc2ccccc2)c(C)c1 |
|
~95%
phenylsulfanyl-... CAS#:50404-53-0 |
| Literature: Imamoto, Tsuneo; Kodera, Masahito; Yokoyama, Masataka Synthesis, 1982 , # 2 p. 134 - 136 |
|
~%
phenylsulfanyl-... CAS#:50404-53-0 |
| Literature: Tarbell; Herz Journal of the American Chemical Society, 1953 , vol. 75, p. 1668,1670 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,4,6-Trimethyl-thiobenzoesaeure-S-phenylester |
| 2,4,6-trimethyl-thiobenzoic acid S-phenyl ester |