5-ethoxy-4-ethoxycarbonyl-5-oxopentanoate structure
|
Common Name | 5-ethoxy-4-ethoxycarbonyl-5-oxopentanoate | ||
|---|---|---|---|---|
| CAS Number | 50408-81-6 | Molecular Weight | 231.22200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15O6- | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-ethoxy-4-ethoxycarbonyl-5-oxopentanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H15O6- |
|---|---|
| Molecular Weight | 231.22200 |
| Exact Mass | 231.08700 |
| PSA | 92.73000 |
| InChIKey | FMYOUXLCWKGJGN-UHFFFAOYSA-M |
| SMILES | CCOC(=O)C(CCC(=O)[O-])C(=O)OCC |
|
~87%
5-ethoxy-4-etho... CAS#:50408-81-6 |
| Literature: Makarevic, Janja; Skaric, Vinko Heterocycles, 1995 , vol. 41, # 6 p. 1207 - 1218 |
|
~92%
5-ethoxy-4-etho... CAS#:50408-81-6 |
| Literature: Raadt, Anna de; Klempier, Norbert; Faber, Kurt; Griengl, Herfried Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1992 , # 1 p. 137 - 140 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,1,3-Propanetricarboxylic acid,1,1-diethyl ester |
| 1,1-diethyl 3-hydrogen propane-1,1,3-tricarboxylate |
| 4,4-diethoxycarbonylbutanoic acid |