MESUAXANTHONE-B structure
|
Common Name | MESUAXANTHONE-B | ||
|---|---|---|---|---|
| CAS Number | 5042-03-5 | Molecular Weight | 244.20000 | |
| Density | 1.64g/cm3 | Boiling Point | 479.3ºC at 760 mmHg | |
| Molecular Formula | C13H8O5 | Melting Point | >300 °C | |
| MSDS | N/A | Flash Point | 192.2ºC | |
| Name | mesuaxanthone B |
|---|---|
| Synonym | More Synonyms |
| Density | 1.64g/cm3 |
|---|---|
| Boiling Point | 479.3ºC at 760 mmHg |
| Melting Point | >300 °C |
| Molecular Formula | C13H8O5 |
| Molecular Weight | 244.20000 |
| Flash Point | 192.2ºC |
| Exact Mass | 244.03700 |
| PSA | 90.90000 |
| LogP | 2.06300 |
| Index of Refraction | 1.758 |
| InChIKey | QVQLOWQNIFSVLU-UHFFFAOYSA-N |
| SMILES | O=c1c2ccc(O)c(O)c2oc2cccc(O)c12 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,5,6-trihydroxyxanthen-9-one |
| 1,5,6-trihydroxy-9H-xanthen-9-one |
| mesuxanthone B |
| 1,5,6-trihydroxy-xanthen-9-one |
| 1,5,6-trihydroxy-9H-xanthenone |
| 1,5,6-Trihydroxy-xanthen-9-on |
| Mesuaxanthone B |
| 1,5,6-trihydroxy-xanthone |