4-Methyl-2-nitrobenzoyl chloride
Modify Date: 2025-08-28 10:49:43
4-Methyl-2-nitrobenzoyl chloride structure
|
Common Name | 4-Methyl-2-nitrobenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 50424-81-2 | Molecular Weight | 199.59100 | |
| Density | 1.386g/cm3 | Boiling Point | 325.3ºC at 760 mmHg | |
| Molecular Formula | C8H6ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.5ºC | |
| Name | 4-Methyl-2-nitrobenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.386g/cm3 |
|---|---|
| Boiling Point | 325.3ºC at 760 mmHg |
| Molecular Formula | C8H6ClNO3 |
| Molecular Weight | 199.59100 |
| Flash Point | 150.5ºC |
| Exact Mass | 199.00400 |
| PSA | 62.89000 |
| LogP | 2.80540 |
| Index of Refraction | 1.579 |
| InChIKey | NGWLWEKYLVWRNX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)Cl)c([N+](=O)[O-])c1 |
| HS Code | 2916399090 |
|---|
|
~%
4-Methyl-2-nitr... CAS#:50424-81-2 |
| Literature: Chou, Yuo-Ling; Davey, David D.; Eagen, Keith A.; Griedel, Brian D.; Karanjawala, Rushad; Phillips, Gary B.; Sacchi, Karna L.; Shaw, Kenneth J.; Wu, Shung C.; Lentz, Dao; Liang, Amy M.; Trinh, Lan; Morrissey, Michael M.; Kochanny, Monica J. Bioorganic and Medicinal Chemistry Letters, 2003 , vol. 13, # 3 p. 507 - 511 |
CAS#:39549-79-6
CAS#:144485-92-7
CAS#:144485-91-6
CAS#:144485-93-8
CAS#:75844-40-5| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-methyl-2-nitro-benzoyl chloride |
| Benzoyl chloride,4-methyl-2-nitro |
| 4-Methyl-2-nitro-benzoylchlorid |
| EINECS 256-587-0 |