2,2,6,6-tetramethyl-1-[6-(2,2,6,6-tetramethylpiperidin-1-yl)hexa-2,4-diynyl]piperidine
Modify Date: 2025-09-15 16:31:43
![2,2,6,6-tetramethyl-1-[6-(2,2,6,6-tetramethylpiperidin-1-yl)hexa-2,4-diynyl]piperidine Structure](https://image.chemsrc.com/caspic/321/50432-81-0.png)
2,2,6,6-tetramethyl-1-[6-(2,2,6,6-tetramethylpiperidin-1-yl)hexa-2,4-diynyl]piperidine structure
|
Common Name | 2,2,6,6-tetramethyl-1-[6-(2,2,6,6-tetramethylpiperidin-1-yl)hexa-2,4-diynyl]piperidine | ||
|---|---|---|---|---|
| CAS Number | 50432-81-0 | Molecular Weight | 356.58800 | |
| Density | 0.902g/cm3 | Boiling Point | 424.9ºC at 760 mmHg | |
| Molecular Formula | C24H40N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.6ºC | |
| Name | 2,2,6,6-tetramethyl-1-[6-(2,2,6,6-tetramethylpiperidin-1-yl)hexa-2,4-diynyl]piperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.902g/cm3 |
|---|---|
| Boiling Point | 424.9ºC at 760 mmHg |
| Molecular Formula | C24H40N2 |
| Molecular Weight | 356.58800 |
| Flash Point | 184.6ºC |
| Exact Mass | 356.31900 |
| PSA | 6.48000 |
| LogP | 4.95520 |
| Index of Refraction | 1.481 |
| InChIKey | NGORXNIHHOTVJG-UHFFFAOYSA-N |
| SMILES | CC1(C)CCCC(C)(C)N1CC#CC#CCN1C(C)(C)CCCC1(C)C |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,2,6,6,2',2',6',6'-octamethyl-1,1'-hexa-2,4-diyne-1,6-diyl-bis-piperidine |