Boc-L-Ala-D-Ala-D-Ala-pNA structure
|
Common Name | Boc-L-Ala-D-Ala-D-Ala-pNA | ||
|---|---|---|---|---|
| CAS Number | 50439-37-7 | Molecular Weight | 451.47400 | |
| Density | 1.261g/cm3 | Boiling Point | 771.8ºC at 760 mmHg | |
| Molecular Formula | C20H29N5O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 420.6ºC | |
| Name | tert-butyl N-[1-[[1-[[1-(4-nitroanilino)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.261g/cm3 |
|---|---|
| Boiling Point | 771.8ºC at 760 mmHg |
| Molecular Formula | C20H29N5O7 |
| Molecular Weight | 451.47400 |
| Flash Point | 420.6ºC |
| Exact Mass | 451.20700 |
| PSA | 171.45000 |
| LogP | 3.22480 |
| Index of Refraction | 1.556 |
| InChIKey | NLHMYSNTLSQYTQ-UHFFFAOYSA-N |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)NC(C)C(=O)NC(C)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
|
~51%
Boc-L-Ala-D-Ala... CAS#:50439-37-7 |
| Literature: Okada; Tsuda; Teno; Nagamatsu; Okamoto; Nishi Chemical and pharmaceutical bulletin, 1985 , vol. 33, # 12 p. 5301 - 5309 |
|
~%
Boc-L-Ala-D-Ala... CAS#:50439-37-7 |
| Literature: Okada; Tsuda; Teno; Nagamatsu; Okamoto; Nishi Chemical and pharmaceutical bulletin, 1985 , vol. 33, # 12 p. 5301 - 5309 |
|
~%
Boc-L-Ala-D-Ala... CAS#:50439-37-7 |
| Literature: Okada; Tsuda; Teno; Nagamatsu; Okamoto; Nishi Chemical and pharmaceutical bulletin, 1985 , vol. 33, # 12 p. 5301 - 5309 |
|
~%
Boc-L-Ala-D-Ala... CAS#:50439-37-7 |
| Literature: Okada; Tsuda; Teno; Nagamatsu; Okamoto; Nishi Chemical and pharmaceutical bulletin, 1985 , vol. 33, # 12 p. 5301 - 5309 |
|
~%
Boc-L-Ala-D-Ala... CAS#:50439-37-7 |
| Literature: Okada; Tsuda; Teno; Nagamatsu; Okamoto; Nishi Chemical and pharmaceutical bulletin, 1985 , vol. 33, # 12 p. 5301 - 5309 |
| L-Alaninamide,N-[(1,1-dimethylethoxy)carbonyl]-L-alanyl-L-alanyl-N-(4-nitrophenyl) |
| Boc-L-Ala-D-Ala-D-Ala-pNA |
| tert-butyl N-[(2S)-1-[[(2S)-1-[[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]carbamate |