4-Aminoquinazolin-2-ol
Modify Date: 2026-06-30 21:13:10
4-Aminoquinazolin-2-ol structure
|
Common Name | 4-Aminoquinazolin-2-ol | ||
|---|---|---|---|---|
| CAS Number | 50440-88-5 | Molecular Weight | 161.161 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 489.6±37.0 °C at 760 mmHg | |
| Molecular Formula | C8H7N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.9±26.5 °C | |
| Name | 4-amino-1H-quinazolin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 489.6±37.0 °C at 760 mmHg |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.161 |
| Flash Point | 249.9±26.5 °C |
| Exact Mass | 161.058914 |
| PSA | 72.03000 |
| LogP | -0.27 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.779 |
| InChIKey | NXBWFXMEJVOABP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC(=O)N2)N |
| HS Code | 2933990090 |
|---|
|
~%
4-Aminoquinazol... CAS#:50440-88-5 |
| Literature: Chien, Tun-Cheng; Chen, Chien-Shu; Yu, Fang-Hwa; Chern, Ji-Wang Chemical and Pharmaceutical Bulletin, 2004 , vol. 52, # 12 p. 1422 - 1426 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Concentration required for inhibition of rat liver dihydrofolate reductase (DHFR)
Source: ChEMBL
Target: Dihydrofolate reductase
External Id: CHEMBL666238
|
|
Name: Inhibition of liver dihydrofolate reductase (unknown origin)
Source: ChEMBL
Target: Dihydrofolate reductase
External Id: CHEMBL3280748
|
Total 2, Current Page 1 of 1
1
| 4-amino-2-quinazolinol |
| 4-Amino-2-hydroxy-chinazolin |
| 4-Amino-2(1H)-quinazolinone |
| 4-Amino-2(3H)-Quinazolinone |
| 4-Aminoquinazolin-2-ol |