benzyl N-[1-[(1-amino-1-oxopropan-2-yl)amino]-1-oxopropan-2-yl]carbamate structure
|
Common Name | benzyl N-[1-[(1-amino-1-oxopropan-2-yl)amino]-1-oxopropan-2-yl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 50444-54-7 | Molecular Weight | 293.31800 | |
| Density | 1.216g/cm3 | Boiling Point | 592.2ºC at 760 mmHg | |
| Molecular Formula | C14H19N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 312ºC | |
| Name | benzyl N-[1-[(1-amino-1-oxopropan-2-yl)amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.216g/cm3 |
|---|---|
| Boiling Point | 592.2ºC at 760 mmHg |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.31800 |
| Flash Point | 312ºC |
| Exact Mass | 293.13800 |
| PSA | 110.52000 |
| LogP | 1.77340 |
| Index of Refraction | 1.543 |
| InChIKey | WEIOJLPDGBBVCH-NXEZZACHSA-N |
| SMILES | CC(NC(=O)C(C)NC(=O)OCc1ccccc1)C(N)=O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Cbz-Ala-Ala-NH2 |
| Z-L-Ala-L-Ala-NH2 |
| Z-Ala-Ala-NH2 |
| Z-(S)-Ala-(S)-Ala-NH2 |
| N-[(benzyloxy)carbonyl]alanylalaninamide |
| Z-L-alanyl-L-alanamide |