3-(4-Benzyloxyphenyl)propionic acid structure
|
Common Name | 3-(4-Benzyloxyphenyl)propionic acid | ||
|---|---|---|---|---|
| CAS Number | 50463-48-4 | Molecular Weight | 256.296 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 429.3±25.0 °C at 760 mmHg | |
| Molecular Formula | C16H16O3 | Melting Point | 116-118 °C | |
| MSDS | N/A | Flash Point | 159.4±16.7 °C | |
| Name | 3-(4-phenylmethoxyphenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 429.3±25.0 °C at 760 mmHg |
| Melting Point | 116-118 °C |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.296 |
| Flash Point | 159.4±16.7 °C |
| Exact Mass | 256.109955 |
| PSA | 46.53000 |
| LogP | 3.41 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | QTSAUVQZNADEKS-UHFFFAOYSA-N |
| SMILES | O=C(O)CCc1ccc(OCc2ccccc2)cc1 |
| HS Code | 2918990090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 8 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| QV2R DO1R |
| Benzenepropanoic acid, 4-(phenylmethoxy)- |
| 3-(4-benzyloxyphenyl)propanoic acid |
| 3-(4-Benzyloxy-phenyl)propionic acid |
| 3-[4-(Benzyloxy)phenyl]propanoic acid |
| 3-(4-Benzyloxyphenyl)propionic acid |
| Benzyloxyphenylpropanoic Acid |