5-Nitro-1,3-benzoxazole-2-carbothioamide
Modify Date: 2026-08-21 20:07:30
5-Nitro-1,3-benzoxazole-2-carbothioamide structure
|
Common Name | 5-Nitro-1,3-benzoxazole-2-carbothioamide | ||
|---|---|---|---|---|
| CAS Number | 50486-47-0 | Molecular Weight | 223.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Nitro-1,3-benzoxazole-2-carbothioamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H5N3O3S |
|---|---|
| Molecular Weight | 223.21 |
| InChIKey | JRWMQGQXTXVKOQ-UHFFFAOYSA-N |
| SMILES | NC(=S)c1nc2cc([N+](=O)[O-])ccc2o1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 5-Nitro-1,3-benzoxazole-2-carbothioamide? |
| A: Molecular weight of 5-Nitro-1,3-benzoxazole-2-carbothioamide is 223.21. |
| Q: What is the SMILES notation of 5-Nitro-1,3-benzoxazole-2-carbothioamide? |
| A: SMILES notation of 5-Nitro-1,3-benzoxazole-2-carbothioamide is NC(=S)c1nc2cc([N+](=O)[O-])ccc2o1. |
| Q: What is the Chinese name of 50486-47-0? |
| A: Chinese name of 50486-47-0 is 50486-47-0. |
| Q: What is the English name of 5-Nitro-1,3-benzoxazole-2-carbothioamide? |
| A: The English name of 5-Nitro-1,3-benzoxazole-2-carbothioamide is 5-Nitro-1,3-benzoxazole-2-carbothioamide. |
| Q: What is the InChIKey of 5-Nitro-1,3-benzoxazole-2-carbothioamide? |
| A: InChIKey of 5-Nitro-1,3-benzoxazole-2-carbothioamide is JRWMQGQXTXVKOQ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 5-Nitro-1,3-benzoxazole-2-carbothioamide? |
| A: CAS number of 5-Nitro-1,3-benzoxazole-2-carbothioamide is 50486-47-0. |
| Q: What is the molecular formula of 5-Nitro-1,3-benzoxazole-2-carbothioamide? |
| A: Molecular formula of 5-Nitro-1,3-benzoxazole-2-carbothioamide is C8H5N3O3S. |