(E)-1-(2-hydroxy-3,4,5,6-tetramethoxyphenyl)-3-phenylprop-2-en-1-one structure
|
Common Name | (E)-1-(2-hydroxy-3,4,5,6-tetramethoxyphenyl)-3-phenylprop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 50489-48-0 | Molecular Weight | 344.35900 | |
| Density | 1.211g/cm3 | Boiling Point | 558.5ºC at 760mmHg | |
| Molecular Formula | C19H20O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.2ºC | |
| Name | (E)-1-(2-hydroxy-3,4,5,6-tetramethoxyphenyl)-3-phenylprop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.211g/cm3 |
|---|---|
| Boiling Point | 558.5ºC at 760mmHg |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.35900 |
| Flash Point | 200.2ºC |
| Exact Mass | 344.12600 |
| PSA | 74.22000 |
| LogP | 3.32270 |
| Index of Refraction | 1.588 |
| InChIKey | LETBAZLAGJPEIM-ZHACJKMWSA-N |
| SMILES | COc1c(O)c(C(=O)C=Cc2ccccc2)c(OC)c(OC)c1OC |
|
~%
(E)-1-(2-hydrox... CAS#:50489-48-0 |
| Literature: Lee,H.H.; Tan,C.H. Journal of the Chemical Society, 1965 , p. 2743 - 2749 |
|
~%
(E)-1-(2-hydrox... CAS#:50489-48-0 |
| Literature: Lee,H.H.; Tan,C.H. Journal of the Chemical Society, 1965 , p. 2743 - 2749 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Kanakugiol |