2-Fluoro-6-phenylpyridine-3-carboxylic acid structure
|
Common Name | 2-Fluoro-6-phenylpyridine-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 505083-01-2 | Molecular Weight | 217.19600 | |
| Density | 1.318g/cm3 | Boiling Point | 390.6ºC at 760 mmHg | |
| Molecular Formula | C12H8FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190ºC | |
| Name | 2-Fluoro-6-phenylpyridine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.318g/cm3 |
|---|---|
| Boiling Point | 390.6ºC at 760 mmHg |
| Molecular Formula | C12H8FNO2 |
| Molecular Weight | 217.19600 |
| Flash Point | 190ºC |
| Exact Mass | 217.05400 |
| PSA | 50.19000 |
| LogP | 2.58590 |
| Index of Refraction | 1.593 |
| InChIKey | KIOCBLSWMMALPQ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-c2ccccc2)nc1F |
| HS Code | 2933399090 |
|---|
|
~65%
2-Fluoro-6-phen... CAS#:505083-01-2 |
| Literature: ELI LILLY AND COMPANY Patent: WO2005/9941 A1, 2005 ; Location in patent: Page 19 ; WO 2005/009941 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-fluoro-6-phenyl-pyridine-3-carboxylic acid |
| QC-8316 |
| 2-Fluoro-6-phenylnicotinic acid |