1-(1-Methylpyrrolidin-2-ylidene)-3-(p-nitrophenyl)urea structure
|
Common Name | 1-(1-Methylpyrrolidin-2-ylidene)-3-(p-nitrophenyl)urea | ||
|---|---|---|---|---|
| CAS Number | 50529-02-7 | Molecular Weight | 262.26500 | |
| Density | 1.374g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H14N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1E)-1-(1-methylpyrrolidin-2-ylidene)-3-(4-nitrophenyl)urea |
|---|
| Density | 1.374g/cm3 |
|---|---|
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.26500 |
| Exact Mass | 262.10700 |
| PSA | 90.52000 |
| LogP | 2.78490 |
| Index of Refraction | 1.645 |
| InChIKey | VAODBZOYKXWEQR-UHFFFAOYSA-N |
| SMILES | CN1CCCC1=NC(=O)Nc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2933990090 |
|---|
|
~%
1-(1-Methylpyrr... CAS#:50529-02-7 |
| Literature: McNeil Laboratories, Incorporated Patent: US3998958 A1, 1976 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |