(2,2-dimethyl-3H-1-benzofuran-7-yl) N-methyl-N-phenylsulfanylcarbamate structure
|
Common Name | (2,2-dimethyl-3H-1-benzofuran-7-yl) N-methyl-N-phenylsulfanylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 50539-66-7 | Molecular Weight | 329.41300 | |
| Density | 1.27g/cm3 | Boiling Point | 444.8ºC at 760 mmHg | |
| Molecular Formula | C18H19NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.8ºC | |
| Name | (2,2-dimethyl-3H-1-benzofuran-7-yl) N-methyl-N-phenylsulfanylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 444.8ºC at 760 mmHg |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.41300 |
| Flash Point | 222.8ºC |
| Exact Mass | 329.10900 |
| PSA | 64.07000 |
| LogP | 4.53800 |
| Index of Refraction | 1.634 |
| InChIKey | AGAFDJJQJCSMQQ-UHFFFAOYSA-N |
| SMILES | CN(Sc1ccccc1)C(=O)Oc1cccc2c1OC(C)(C)C2 |
| HS Code | 2932999099 |
|---|
|
~%
(2,2-dimethyl-3... CAS#:50539-66-7 |
| Literature: The Regents of the University of California Patent: US3997549 A1, 1976 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-Phenylsulfenyl carbofuran |
| 2,2-Dimethyl-2,3-dihydrobenzofuran-7-yl N-methyl-N-phenylthiocarbamate |
| N-Benzenesulfenylcarbofuran |