1,4-bis(methylsulfonyloxy)butan-2-ol structure
|
Common Name | 1,4-bis(methylsulfonyloxy)butan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 5055-10-7 | Molecular Weight | 262.30100 | |
| Density | 1.455g/cm3 | Boiling Point | 540.5ºC at 760 mmHg | |
| Molecular Formula | C6H14O7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.7ºC | |
| Name | (3-hydroxy-4-methylsulfonyloxybutyl) methanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.455g/cm3 |
|---|---|
| Boiling Point | 540.5ºC at 760 mmHg |
| Molecular Formula | C6H14O7S2 |
| Molecular Weight | 262.30100 |
| Flash Point | 280.7ºC |
| Exact Mass | 262.01800 |
| PSA | 123.73000 |
| LogP | 0.85140 |
| Index of Refraction | 1.493 |
| InChIKey | RGMSIGKBRQRMBD-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCCC(O)COS(C)(=O)=O |
|
~73%
1,4-bis(methyls... CAS#:5055-10-7 |
| Literature: Boger, Dale L.; Panek, James S. Journal of Organic Chemistry, 1981 , vol. 46, # 6 p. 1208 - 1210 |
|
~84%
1,4-bis(methyls... CAS#:5055-10-7 |
| Literature: Goti, Andrea; Cicchi, Stefano; Fedi, Valentina; Nannelli, Luca; Brandi, Alberto Journal of Organic Chemistry, 1997 , vol. 62, # 10 p. 3119 - 3125 |
|
~%
1,4-bis(methyls... CAS#:5055-10-7 |
| Literature: Feit; Nielsen Journal of medicinal chemistry, 1966 , vol. 9, # 3 p. 416 - 417 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (S)-1,2,4-butanetriol 1,4-bis(methanesulfonate) |
| 2-hydroxybutane-1,4-diyl dimethanesulfonate |
| (S)-1,2,4-Butantriol-1,4-bismethansulfonat |
| (2S)-2-hydroxy-1,4-bis<(methansulfonyl)oxy>butane |