1-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)benzene structure
|
Common Name | 1-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 50562-22-6 | Molecular Weight | 228.13400 | |
| Density | 1.325g/cm3 | Boiling Point | 136.9ºC at 760mmHg | |
| Molecular Formula | C9H6F6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 34.1ºC | |
| Name | 1-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.325g/cm3 |
|---|---|
| Boiling Point | 136.9ºC at 760mmHg |
| Molecular Formula | C9H6F6 |
| Molecular Weight | 228.13400 |
| Flash Point | 34.1ºC |
| Exact Mass | 228.03700 |
| LogP | 3.81020 |
| Index of Refraction | 1.394 |
| InChIKey | ZDMPOTKYTHEWOD-UHFFFAOYSA-N |
| SMILES | FC(F)(F)Cc1cccc(C(F)(F)F)c1 |
| HS Code | 2903999090 |
|---|
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,1,1-Trifluor-2-(m-trifluormethylphenyl)ethan |