N-[2-(2-amino-3H-imidazol-4-yl)ethyl]-2,2,2-trifluoro-acetamide structure
|
Common Name | N-[2-(2-amino-3H-imidazol-4-yl)ethyl]-2,2,2-trifluoro-acetamide | ||
|---|---|---|---|---|
| CAS Number | 50580-60-4 | Molecular Weight | 222.16800 | |
| Density | 1.467g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H9F3N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[2-(2-amino-1H-imidazol-5-yl)ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.467g/cm3 |
|---|---|
| Molecular Formula | C7H9F3N4O |
| Molecular Weight | 222.16800 |
| Exact Mass | 222.07300 |
| PSA | 83.80000 |
| LogP | 1.18500 |
| Index of Refraction | 1.518 |
| InChIKey | CYRLCCWKLKXOGT-UHFFFAOYSA-N |
| SMILES | Nc1ncc(CCNC(=O)C(F)(F)F)[nH]1 |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-[2-(2-amino-1(3)H-imidazol-4-yl)-ethyl]-2,2,2-trifluoro-acetamide |
| Histamine,N-TFA-2-amino |
| Histamine,N-trifluoroacetyl-2-amino |
| N-[2-(2-AMINO-3H-IMIDAZOL-4-YL)ETHYL]-2,2,2-TRIFLUORO-ACETAMIDE |