4-Chloro-6-methoxy-2-phenylquinoline structure
|
Common Name | 4-Chloro-6-methoxy-2-phenylquinoline | ||
|---|---|---|---|---|
| CAS Number | 50593-72-1 | Molecular Weight | 269.72600 | |
| Density | 1.237g/cm3 | Boiling Point | 414.3ºC at 760 mmHg | |
| Molecular Formula | C16H12ClNO | Melting Point | 121ºC | |
| MSDS | N/A | Flash Point | 204.4ºC | |
| Name | 4-Chloro-6-methoxy-2-phenylquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.237g/cm3 |
|---|---|
| Boiling Point | 414.3ºC at 760 mmHg |
| Melting Point | 121ºC |
| Molecular Formula | C16H12ClNO |
| Molecular Weight | 269.72600 |
| Flash Point | 204.4ºC |
| Exact Mass | 269.06100 |
| PSA | 22.12000 |
| LogP | 4.56380 |
| Index of Refraction | 1.638 |
| InChIKey | JUDKYVTYOZVODY-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc(-c3ccccc3)cc(Cl)c2c1 |
| HS Code | 2933499090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-chloro-6-methoxy-2-phenyl-quinoline |
| 4-Chlor-6-methoxy-2-phenyl-chinolin |
| 2-Phenyl-6-methoxy-4-chlorchinolin |