3-(2-aminophenyl)-1-benzyl-thiourea structure
|
Common Name | 3-(2-aminophenyl)-1-benzyl-thiourea | ||
|---|---|---|---|---|
| CAS Number | 50596-93-5 | Molecular Weight | 257.35400 | |
| Density | 1.272g/cm3 | Boiling Point | 421.6ºC at 760 mmHg | |
| Molecular Formula | C14H15N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.8ºC | |
| Name | 1-(2-aminophenyl)-3-benzylthiourea |
|---|
| Density | 1.272g/cm3 |
|---|---|
| Boiling Point | 421.6ºC at 760 mmHg |
| Molecular Formula | C14H15N3S |
| Molecular Weight | 257.35400 |
| Flash Point | 208.8ºC |
| Exact Mass | 257.09900 |
| PSA | 82.17000 |
| LogP | 3.80050 |
| Index of Refraction | 1.722 |
| InChIKey | KRJFMHAJXWUTGY-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1NC(=S)NCc1ccccc1 |
|
~65%
3-(2-aminopheny... CAS#:50596-93-5 |
| Literature: Scheffer, Ute; Strick, Andreas; Ludwig, Verena; Peter, Sascha; Kalden, Elisabeth; Goebel, Michael W. Journal of the American Chemical Society, 2005 , vol. 127, # 7 p. 2211 - 2217 |