6-Hydroxy-2-methyl-3-(2-methylphenyl)quinazolin-4(3H)-one structure
|
Common Name | 6-Hydroxy-2-methyl-3-(2-methylphenyl)quinazolin-4(3H)-one | ||
|---|---|---|---|---|
| CAS Number | 5060-51-5 | Molecular Weight | 266.29500 | |
| Density | 1.25g/cm3 | Boiling Point | 477.5ºC at 760 mmHg | |
| Molecular Formula | C16H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.6ºC | |
| Name | 6-hydroxy-2-methyl-3-(2-methylphenyl)quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 477.5ºC at 760 mmHg |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.29500 |
| Flash Point | 242.6ºC |
| Exact Mass | 266.10600 |
| PSA | 55.12000 |
| LogP | 2.70810 |
| Index of Refraction | 1.642 |
| InChIKey | NHGHFELYOIWDRR-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1-n1c(C)nc2ccc(O)cc2c1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-hydroxy-2-methyl-3-o-tolyl-3H-quinazolin-4-one |
| 6-Hydroxy-methaqualon |
| 6-Hydroxymethaqualone |