N-dimethoxyphosphoryladamantan-1-amine structure
|
Common Name | N-dimethoxyphosphoryladamantan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 50607-00-6 | Molecular Weight | 259.28200 | |
| Density | 1.18g/cm3 | Boiling Point | 321.7ºC at 760 mmHg | |
| Molecular Formula | C12H22NO3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.4ºC | |
| Name | N-dimethoxyphosphoryladamantan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 321.7ºC at 760 mmHg |
| Molecular Formula | C12H22NO3P |
| Molecular Weight | 259.28200 |
| Flash Point | 148.4ºC |
| Exact Mass | 259.13400 |
| PSA | 57.37000 |
| LogP | 3.33660 |
| Index of Refraction | 1.508 |
| InChIKey | BGQNGIYVQQLEHL-UHFFFAOYSA-N |
| SMILES | COP(=O)(NC12CC3CC(CC(C3)C1)C2)OC |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Dimethyl-N-1-adamantylphosphoramidat |
| Dimethyl N-1-adamantylphosphoramidate |