1,2-Cyclopentanediol,3-[(2,5-diamino-6-chloro-4-pyrimidinyl)amino]-5-(hydroxymethyl)-,(1R,2S,3R,5R)-rel- structure
|
Common Name | 1,2-Cyclopentanediol,3-[(2,5-diamino-6-chloro-4-pyrimidinyl)amino]-5-(hydroxymethyl)-,(1R,2S,3R,5R)-rel- | ||
|---|---|---|---|---|
| CAS Number | 50619-39-1 | Molecular Weight | 289.71900 | |
| Density | 1.712g/cm3 | Boiling Point | 636.5ºC at 760 mmHg | |
| Molecular Formula | C10H16ClN5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 338.7ºC | |
| Name | 3-[(2,5-diamino-6-chloropyrimidin-4-yl)amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|
| Density | 1.712g/cm3 |
|---|---|
| Boiling Point | 636.5ºC at 760 mmHg |
| Molecular Formula | C10H16ClN5O3 |
| Molecular Weight | 289.71900 |
| Flash Point | 338.7ºC |
| Exact Mass | 289.09400 |
| PSA | 150.54000 |
| LogP | 0.04430 |
| Index of Refraction | 1.784 |
| InChIKey | ANUOZHOHGLIAFZ-UHFFFAOYSA-N |
| SMILES | Nc1nc(Cl)c(N)c(NC2CC(CO)C(O)C2O)n1 |
|
~71%
1,2-Cyclopentan... CAS#:50619-39-1 |
| Literature: Legraverend; Boumchita; Bisagni Synthesis, 1990 , # 7 p. 587 - 589 |
|
~%
1,2-Cyclopentan... CAS#:50619-39-1 |
| Literature: Lee; Vince Journal of Pharmaceutical Sciences, 1980 , vol. 69, # 9 p. 1019 - 1021 |
|
~%
1,2-Cyclopentan... CAS#:50619-39-1 |
| Literature: Lee; Vince Journal of Pharmaceutical Sciences, 1980 , vol. 69, # 9 p. 1019 - 1021 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |