AURORA KA-3504 structure
|
Common Name | AURORA KA-3504 | ||
|---|---|---|---|---|
| CAS Number | 50628-42-7 | Molecular Weight | 274.315 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 463.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.4±28.7 °C | |
| Name | 4,5,7-trihydroxy-9,10-dioxoanthracene-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 463.9±45.0 °C at 760 mmHg |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.315 |
| Flash Point | 234.4±28.7 °C |
| Exact Mass | 274.131744 |
| PSA | 58.64000 |
| LogP | 2.07 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.540 |
| InChIKey | GRZXAQPDZOWXCI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C)N(C)C(=O)NC1c1ccccc1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ANTHROIC ACID,9,10-DIHYDRO-4,5,7-TRIHYDROXY-9,10-DIOXO |
| 5-ethoxycarbonyl-1,6-dimethyl-4-phenyl-3,4-dihydropyrimidin-2(1H)-one |
| 9,10-Dihydro-4,5,7-trihydroxy-9,10-dioxoanthroic acid |
| ethyl 1,6-dimethyl-4-phenyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Ethyl 1,6-dimethyl-2-oxo-4-phenyl-1,2,3,4-tetrahydro-5-pyrimidinecarboxylate |
| ethyl 1,2,3,4-tetrahydro-1,6-dimethyl-2-oxo-4-phenylpyrimidine-5-carboxylate |
| 1,6-Dimethyl-2-oxo-4-phenyl-1,2,3,4-tetrahydro-pyrimidin-5-carbonsaeure-aethylester |
| 1,6-dimethyl-2-oxo-4-phenyl-1,2,3,4-tetrahydro-pyrimidine-5-carboxylic acid ethyl ester |
| ethyl 1,6-dimethyl-2-oxo-4-phenyl-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| 5-Pyrimidinecarboxylic acid, 1,2,3,4-tetrahydro-1,6-dimethyl-2-oxo-4-phenyl-, ethyl ester |
| 4,5,7-trihydroxy-9,10-dioxo-9,10-dihydroanthracene-1-carboxylic acid |