3,4-dimethoxy-5-phenylmethoxybenzoyl chloride structure
|
Common Name | 3,4-dimethoxy-5-phenylmethoxybenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 5065-11-2 | Molecular Weight | 306.74100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,4-dimethoxy-5-phenylmethoxybenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H15ClO4 |
|---|---|
| Molecular Weight | 306.74100 |
| Exact Mass | 306.06600 |
| PSA | 44.76000 |
| LogP | 3.66180 |
| InChIKey | DNKKAZLWTQUFMR-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)Cl)cc(OCc2ccccc2)c1OC |
| HS Code | 2918990090 |
|---|
|
~%
3,4-dimethoxy-5... CAS#:5065-11-2 |
| Literature: Scott,A.I. et al. Tetrahedron, 1965 , vol. 21, p. 3605 - 3631 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4,5-Dimethoxy-3-benzyloxyl-benzoylchlorid |
| 3-Benzyloxy-4,5-dimethoxybenzoylchlorid |
| 3-benzyloxy-4,5-dimethoxybenzoylchloride |