3-Chloro-4-hydroxybenzoic acid 4-pentylphenyl ester structure
|
Common Name | 3-Chloro-4-hydroxybenzoic acid 4-pentylphenyl ester | ||
|---|---|---|---|---|
| CAS Number | 50687-70-2 | Molecular Weight | 318.79500 | |
| Density | 1.2g/cm3 | Boiling Point | 462.8ºC at 760 mmHg | |
| Molecular Formula | C18H19ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.7ºC | |
| Name | (4-pentylphenyl) 3-chloro-4-hydroxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 462.8ºC at 760 mmHg |
| Molecular Formula | C18H19ClO3 |
| Molecular Weight | 318.79500 |
| Flash Point | 233.7ºC |
| Exact Mass | 318.10200 |
| PSA | 46.53000 |
| LogP | 4.99750 |
| Index of Refraction | 1.577 |
| InChIKey | MBWAFEFPEJYWGU-UHFFFAOYSA-N |
| SMILES | CCCCCc1ccc(OC(=O)c2ccc(O)c(Cl)c2)cc1 |
| HS Code | 2918290000 |
|---|
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 4-Pentylphenyl 3-chloro-4-hydroxybenzoate |
| 3-Chloro-4-hydroxybenzoic acid 4-pentylphenyl ester |
| Benzoic acid,3-chloro-4-hydroxy-,4-pentylphenyl ester |