3-(5H-purin-6-ylsulfanylmethyl)phenol
Modify Date: 2025-09-13 17:22:04
3-(5H-purin-6-ylsulfanylmethyl)phenol structure
|
Common Name | 3-(5H-purin-6-ylsulfanylmethyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 5069-71-6 | Molecular Weight | 258.29900 | |
| Density | 1.51g/cm3 | Boiling Point | 468.3ºC at 760 mmHg | |
| Molecular Formula | C12H10N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237ºC | |
| Name | 3-(7H-purin-6-ylsulfanylmethyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 468.3ºC at 760 mmHg |
| Molecular Formula | C12H10N4OS |
| Molecular Weight | 258.29900 |
| Flash Point | 237ºC |
| Exact Mass | 258.05800 |
| PSA | 99.99000 |
| LogP | 2.35080 |
| Index of Refraction | 1.77 |
| InChIKey | UJEKAKVANKOUMM-UHFFFAOYSA-N |
| SMILES | Oc1cccc(CSc2ncnc3nc[nH]c23)c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-[(7H-purin-6-ylsulfanyl)methyl]phenol |
| 3-(7(9)H-purin-6-ylmercapto-methyl)-phenol |