6-[(4-chlorophenyl)methylsulfanyl]-5H-purin-2-amine structure
|
Common Name | 6-[(4-chlorophenyl)methylsulfanyl]-5H-purin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 5069-76-1 | Molecular Weight | 291.75900 | |
| Density | 1.62g/cm3 | Boiling Point | 468ºC at 760 mmHg | |
| Molecular Formula | C12H10ClN5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.8ºC | |
| Name | 6-[(4-chlorophenyl)methylsulfanyl]-7H-purin-2-amine |
|---|
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 468ºC at 760 mmHg |
| Molecular Formula | C12H10ClN5S |
| Molecular Weight | 291.75900 |
| Flash Point | 236.8ºC |
| Exact Mass | 291.03500 |
| PSA | 105.78000 |
| LogP | 3.46200 |
| Index of Refraction | 1.798 |
| InChIKey | LXTIMTIDPYWJIX-UHFFFAOYSA-N |
| SMILES | Nc1nc(SCc2ccc(Cl)cc2)c2[nH]cnc2n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |