2-Chloro-1-(2,3,5,6-tetramethylphenyl)ethanone structure
|
Common Name | 2-Chloro-1-(2,3,5,6-tetramethylphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 50690-13-6 | Molecular Weight | 210.70000 | |
| Density | 1.067g/cm3 | Boiling Point | 322ºC at 760 mmHg | |
| Molecular Formula | C12H15ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.6ºC | |
| Name | 2-Chloro-1-(2,3,5,6-tetramethylphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.067g/cm3 |
|---|---|
| Boiling Point | 322ºC at 760 mmHg |
| Molecular Formula | C12H15ClO |
| Molecular Weight | 210.70000 |
| Flash Point | 178.6ºC |
| Exact Mass | 210.08100 |
| PSA | 17.07000 |
| LogP | 3.34170 |
| Index of Refraction | 1.524 |
| InChIKey | MYXVCQGMHOQBLZ-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C)c(C(=O)CCl)c1C |
| HS Code | 2914700090 |
|---|
|
~%
2-Chloro-1-(2,3... CAS#:50690-13-6 |
| Literature: Leonardi; Nardi; Frigerio; Trka Farmaco, Edizione Scientifica, 1978 , vol. 33, # 5 p. 364 - 381 |
|
~82%
2-Chloro-1-(2,3... CAS#:50690-13-6 |
| Literature: Leonardi; Motta; Subissi; Nardi Farmaco, Edizione Scientifica, 1981 , vol. 36, # 8 p. 711 - 720 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3-chloroacetyl-durene |