2-ethylhexyl 2-methylprop-2-enoate,2-methylpropyl 2-methylprop-2-enoate,styrene structure
|
Common Name | 2-ethylhexyl 2-methylprop-2-enoate,2-methylpropyl 2-methylprop-2-enoate,styrene | ||
|---|---|---|---|---|
| CAS Number | 50698-69-6 | Molecular Weight | 444.64700 | |
| Density | N/A | Boiling Point | 234.8ºC at 760mmHg | |
| Molecular Formula | C28H44O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 91.4ºC | |
| Name | 2-ethylhexyl 2-methylprop-2-enoate,2-methylpropyl 2-methylprop-2-enoate,styrene |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 234.8ºC at 760mmHg |
|---|---|
| Molecular Formula | C28H44O4 |
| Molecular Weight | 444.64700 |
| Flash Point | 91.4ºC |
| Exact Mass | 444.32400 |
| PSA | 52.60000 |
| LogP | 7.41340 |
| InChIKey | FBSCSYSONCUOHR-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCC(C)C.C=C(C)C(=O)OCC(CC)CCCC.C=Cc1ccccc1 |
| 2-ethylhexyl 2-methylprop-2-enoate |
| 2-Propenoic acid,2-methyl-,2-ethylhexyl ester,polymer with ethenylbenzene and 2-methylpropyl 2-methyl-2-propenoate |
| Benzene,ethenyl-,polymer with 2-ethylhexyl 2-methyl-2-propenoate and 2-methylpropyl 2-methyl-2-propenoate |