methyl 4-[(4-bromophenyl)methylidene]-1-cyclohexyl-2-methyl-5-oxopyrrole-3-carboxylate structure
|
Common Name | methyl 4-[(4-bromophenyl)methylidene]-1-cyclohexyl-2-methyl-5-oxopyrrole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 5071-69-2 | Molecular Weight | 404.29800 | |
| Density | 1.407g/cm3 | Boiling Point | 545.9ºC at 760mmHg | |
| Molecular Formula | C20H22BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284ºC | |
| Name | methyl 4-[(4-bromophenyl)methylidene]-1-cyclohexyl-2-methyl-5-oxopyrrole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.407g/cm3 |
|---|---|
| Boiling Point | 545.9ºC at 760mmHg |
| Molecular Formula | C20H22BrNO3 |
| Molecular Weight | 404.29800 |
| Flash Point | 284ºC |
| Exact Mass | 403.07800 |
| PSA | 46.61000 |
| LogP | 4.39230 |
| Index of Refraction | 1.624 |
| InChIKey | FTCCSWQUIGLRLH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C)N(C2CCCCC2)C(=O)C1=Cc1ccc(Br)cc1 |
|
~%
methyl 4-[(4-br... CAS#:5071-69-2 |
| Literature: Wiberg,K.B. et al. Tetrahedron, 1965 , vol. 21, p. 2749 - 2769 |
|
~%
methyl 4-[(4-br... CAS#:5071-69-2 |
| Literature: Chae, Woo-Ki; Baughman, Sharon A.; Engel, Paul S.; Bruch, Manfred; Oezmeral, Cenan; et al. Journal of the American Chemical Society, 1981 , vol. 103, # 16 p. 4824 - 4833 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,1-Dichlor-penta-1,4-dien-4-carbonsaeure-methylester |