DI-(5-CHOLESTEN-3BETA-OL) 3,3'-SULFITE structure
|
Common Name | DI-(5-CHOLESTEN-3BETA-OL) 3,3'-SULFITE | ||
|---|---|---|---|---|
| CAS Number | 50736-01-1 | Molecular Weight | 819.35600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C54H90O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3α)-Cholest-5-en-3-yl (3β)-cholest-5-en-3-yl sulfite |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C54H90O3S |
|---|---|
| Molecular Weight | 819.35600 |
| Exact Mass | 818.66100 |
| PSA | 54.74000 |
| LogP | 16.28400 |
| InChIKey | HLGNAFRHPNDEGO-CZSGSNDGSA-N |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OS(=O)OC5CCC6(C)C(=CCC7C6CCC6(C)C(C(C)CCCC(C)C)CCC76)C5)CCC4(C)C3CCC12C |
|
~%
DI-(5-CHOLESTEN... CAS#:50736-01-1 |
| Literature: Daughenbaugh; Allison Journal of the American Chemical Society, 1929 , vol. 51, p. 3665,3667 |
|
~%
DI-(5-CHOLESTEN... CAS#:50736-01-1 |
| Literature: Daughenbaugh; Allison Journal of the American Chemical Society, 1929 , vol. 51, p. 3665,3667 |
|
~%
Detail
|
|
Literature: Kitasato; Sone Chemische Berichte, 1931 , vol. 64, p. 1142,1145 Full Text Show Details Daeumer,E. Diss. |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| sulfurous acid diallyl ester |
| Schwefligsaeure-diallylester |
| Schwefligsaeure-dicholesterylester |
| Diallylsulfit |
| Dicholesteryl-sulfit |
| Sulfurous acid,di-2-propenyl ester |
| dicholesteryl sulfite |