3-nitro-N-(3-nitrophenyl)diazenyl-aniline structure
|
Common Name | 3-nitro-N-(3-nitrophenyl)diazenyl-aniline | ||
|---|---|---|---|---|
| CAS Number | 5076-50-6 | Molecular Weight | 287.23100 | |
| Density | 1.48g/cm3 | Boiling Point | 445.8ºC at 760 mmHg | |
| Molecular Formula | C12H9N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.4ºC | |
| Name | 3-nitro-N-[(3-nitrophenyl)diazenyl]aniline |
|---|
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 445.8ºC at 760 mmHg |
| Molecular Formula | C12H9N5O4 |
| Molecular Weight | 287.23100 |
| Flash Point | 223.4ºC |
| Exact Mass | 287.06500 |
| PSA | 128.39000 |
| LogP | 4.73320 |
| Index of Refraction | 1.68 |
| InChIKey | QFVCXCJCBCTQAP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(N=NNc2cccc([N+](=O)[O-])c2)c1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |