4-Hexyloxyphenyl 4-Pentylbenzoate structure
|
Common Name | 4-Hexyloxyphenyl 4-Pentylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 50802-52-3 | Molecular Weight | 368.50900 | |
| Density | 1.018g/cm3 | Boiling Point | 491.7ºC at 760 mmHg | |
| Molecular Formula | C24H32O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Hexyloxyphenyl 4-Pentylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.018g/cm3 |
|---|---|
| Boiling Point | 491.7ºC at 760 mmHg |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.50900 |
| Exact Mass | 368.23500 |
| PSA | 35.53000 |
| LogP | 6.59760 |
| Index of Refraction | 1.526 |
| InChIKey | QOSDDNTYRMLJLY-UHFFFAOYSA-N |
| SMILES | CCCCCCOc1ccc(OC(=O)c2ccc(CCCCC)cc2)cc1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| (4-hexoxyphenyl) 4-pentylbenzoate |
| 4-Pentylbenzoic Acid 4-Hexyloxyphenyl Ester |
| 4-Amylbenzoic Acid 4-Hexyloxyphenyl Ester |