1,2,3-trimethoxy-5-phenylbenzene
1,2,3-trimethoxy-5-phenylbenzene structure
|
Common Name | 1,2,3-trimethoxy-5-phenylbenzene | ||
|---|---|---|---|---|
| CAS Number | 50816-75-6 | Molecular Weight | 244.28600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2,3-trimethoxy-5-phenylbenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H16O3 |
|---|---|
| Molecular Weight | 244.28600 |
| Exact Mass | 244.11000 |
| PSA | 27.69000 |
| LogP | 3.37940 |
| InChIKey | FZELAUWRSAKWRF-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2ccccc2)cc(OC)c1OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 1 | |
CAS#:2675-79-8
CAS#:98-80-6
CAS#:108-86-1
CAS#:182163-96-8
CAS#:71-43-2
CAS#:6307-90-0
CAS#:24313-88-0
CAS#:1353221-22-3
CAS#:25245-29-8
CAS#:3687-28-3This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Cytotoxicity against human HCT15 cells by SRB assay
Source: ChEMBL
Target: HCT-15
External Id: CHEMBL1109334
|
|
Name: Cytotoxicity against human SK-MEL-2 cells by SRB assay
Source: ChEMBL
Target: SK-MEL-2
External Id: CHEMBL1109333
|
|
Name: Cytotoxicity against human SKOV3 cells by SRB assay
Source: ChEMBL
Target: SK-OV-3
External Id: CHEMBL1109332
|
|
Name: Cytotoxicity against human A549 cells by SRB assay
Source: ChEMBL
Target: A549
External Id: CHEMBL1109331
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Methoxyaucuparin |
| 1,1'-Biphenyl,3,4,5-trimethoxy |
| 5-phenyl-1,2,3-trimethoxybenzene |
| 3,4,5-Trimethoxy-biphenyl |
| Aucuparin-methylether |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1,2,3-trimethoxy-5-phenylbenzene? |
| A: InChIKey of 1,2,3-trimethoxy-5-phenylbenzene is FZELAUWRSAKWRF-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 1,2,3-trimethoxy-5-phenylbenzene? |
| A: Related upstream materials(CAS) of 1,2,3-trimethoxy-5-phenylbenzene: 2675-79-8;98-80-6;108-86-1;182163-96-8;71-43-2;6307-90-0;24313-88-0;1353221-22-3;25245-29-8. |
| Q: What is the polar surface area (PSA) of 1,2,3-trimethoxy-5-phenylbenzene? |
| A: Polar surface area (PSA) of 1,2,3-trimethoxy-5-phenylbenzene is 27.69000. |
| Q: What are the downstream products of 1,2,3-trimethoxy-5-phenylbenzene? |
| A: Related downstream products(CAS) of 1,2,3-trimethoxy-5-phenylbenzene: 3687-28-3. |
| Q: What is the molecular formula of 1,2,3-trimethoxy-5-phenylbenzene? |
| A: Molecular formula of 1,2,3-trimethoxy-5-phenylbenzene is C15H16O3. |
| Q: What English synonyms does 1,2,3-trimethoxy-5-phenylbenzene have? |
| A: English synonyms of 1,2,3-trimethoxy-5-phenylbenzene: Methoxyaucuparin, 1,1'-Biphenyl,3,4,5-trimethoxy, 5-phenyl-1,2,3-trimethoxybenzene, 3,4,5-Trimethoxy-biphenyl, Aucuparin-methylether. |
| Q: What is the LogP of 1,2,3-trimethoxy-5-phenylbenzene? |
| A: LogP of 1,2,3-trimethoxy-5-phenylbenzene is 3.37940. |
| Q: What is the molecular weight of 1,2,3-trimethoxy-5-phenylbenzene? |
| A: Molecular weight of 1,2,3-trimethoxy-5-phenylbenzene is 244.28600. |
| Q: What is the SMILES notation of 1,2,3-trimethoxy-5-phenylbenzene? |
| A: SMILES notation of 1,2,3-trimethoxy-5-phenylbenzene is COc1cc(-c2ccccc2)cc(OC)c1OC. |
| Q: What is the CAS number of 1,2,3-trimethoxy-5-phenylbenzene? |
| A: CAS number of 1,2,3-trimethoxy-5-phenylbenzene is 50816-75-6. |