Methyl 2-(benzyloxy)-5-nitrobenzenecarboxylate structure
|
Common Name | Methyl 2-(benzyloxy)-5-nitrobenzenecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 508211-52-7 | Molecular Weight | 287.26700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 5-nitro-2-phenylmethoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H13NO5 |
|---|---|
| Molecular Weight | 287.26700 |
| Exact Mass | 287.07900 |
| PSA | 81.35000 |
| LogP | 3.48360 |
| InChIKey | PDIGFLHAAMEDEU-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc([N+](=O)[O-])ccc1OCc1ccccc1 |
| HS Code | 2918990090 |
|---|
|
~78%
Methyl 2-(benzy... CAS#:508211-52-7 |
| Literature: Takeda Chemical Industries, Ltd. Patent: EP1437344 A1, 2004 ; Location in patent: Page 69 ; |
|
~%
Methyl 2-(benzy... CAS#:508211-52-7 |
| Literature: Foye; Feldmann Journal of the American Pharmaceutical Association (1912-1977), 1955 , vol. 44, p. 467,470 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Methyl 2-(benzyloxy)-5-nitrobenzoate |
| Methyl 2-(benzyloxy)-5-nitrobenzenecarboxylate |
| HD-0002 |
| 2-benzyloxy-5-nitro-benzoic acid methyl ester |
| 2-Benzyloxy-5-nitro-benzoesaeure-methylester |