2,5-Cyclohexadiene-1,4-dione,3,5-dimethoxy-2-[[[(methylamino)carbonyl]oxy]methyl]-
Modify Date: 2025-10-09 11:32:03
![2,5-Cyclohexadiene-1,4-dione,3,5-dimethoxy-2-[[[(methylamino)carbonyl]oxy]methyl]- Structure](https://image.chemsrc.com/caspic/492/50827-63-9.png)
2,5-Cyclohexadiene-1,4-dione,3,5-dimethoxy-2-[[[(methylamino)carbonyl]oxy]methyl]- structure
|
Common Name | 2,5-Cyclohexadiene-1,4-dione,3,5-dimethoxy-2-[[[(methylamino)carbonyl]oxy]methyl]- | ||
|---|---|---|---|---|
| CAS Number | 50827-63-9 | Molecular Weight | 255.22400 | |
| Density | 1.3g/cm3 | Boiling Point | 442.8ºC at 760 mmHg | |
| Molecular Formula | C11H13NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.6ºC | |
| Name | (2,4-dimethoxy-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl N-methylcarbamate |
|---|
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 442.8ºC at 760 mmHg |
| Molecular Formula | C11H13NO6 |
| Molecular Weight | 255.22400 |
| Flash Point | 221.6ºC |
| Exact Mass | 255.07400 |
| PSA | 90.93000 |
| LogP | 0.31590 |
| Index of Refraction | 1.518 |
| InChIKey | DUBXAGKGDKBSND-UHFFFAOYSA-N |
| SMILES | CNC(=O)OCC1=C(OC)C(=O)C(OC)=CC1=O |
|
~%
2,5-Cyclohexadi... CAS#:50827-63-9 |
| Literature: Witty,T.R.; Remers,W.A. Journal of Medicinal Chemistry, 1973 , vol. 16, p. 1280 - 1284 |
|
~%
2,5-Cyclohexadi... CAS#:50827-63-9 |
| Literature: Witty,T.R.; Remers,W.A. Journal of Medicinal Chemistry, 1973 , vol. 16, p. 1280 - 1284 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |