1-[2-[2-(5-nitrofuran-2-yl)ethenyl]imidazol-1-yl]ethanone
![1-[2-[2-(5-nitrofuran-2-yl)ethenyl]imidazol-1-yl]ethanone Structure](https://image.chemsrc.com/caspic/255/50832-67-2.png)
1-[2-[2-(5-nitrofuran-2-yl)ethenyl]imidazol-1-yl]ethanone structure
|
Common Name | 1-[2-[2-(5-nitrofuran-2-yl)ethenyl]imidazol-1-yl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 50832-67-2 | Molecular Weight | 247.20700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[2-[2-(5-nitrofuran-2-yl)ethenyl]imidazol-1-yl]ethanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H9N3O4 |
|---|---|
| Molecular Weight | 247.20700 |
| Exact Mass | 247.05900 |
| PSA | 93.85000 |
| LogP | 2.73800 |
| InChIKey | TVAGLKQFHLKALE-UHFFFAOYSA-N |
| SMILES | CC(=O)n1ccnc1C=Cc1ccc([N+](=O)[O-])o1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-[2-[2-(5-nitr... CAS#:50832-67-2 |
| Literature: Henry; Brown; Cory; et al. Journal of Medicinal Chemistry, 1973 , vol. 16, # 11 p. 1287 - 1291 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![1H-Imidazole,2-[2-(5-nitro-2-furanyl)ethenyl] structure](https://image.chemsrc.com/caspic/162/6756-33-8.png)
CAS#:6756-33-8This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 50832-67-2? |
| A: Chinese name of 50832-67-2 is 50832-67-2. |
| Q: What are the downstream products of 1-[2-[2-(5-nitrofuran-2-yl)ethenyl]imidazol-1-yl]ethanone? |
| A: Related downstream products(CAS) of 1-[2-[2-(5-nitrofuran-2-yl)ethenyl]imidazol-1-yl]ethanone: 6756-33-8. |
| Q: What is the LogP of 1-[2-[2-(5-nitrofuran-2-yl)ethenyl]imidazol-1-yl]ethanone? |
| A: LogP of 1-[2-[2-(5-nitrofuran-2-yl)ethenyl]imidazol-1-yl]ethanone is 2.73800. |
| Q: What is the molecular weight of 1-[2-[2-(5-nitrofuran-2-yl)ethenyl]imidazol-1-yl]ethanone? |
| A: Molecular weight of 1-[2-[2-(5-nitrofuran-2-yl)ethenyl]imidazol-1-yl]ethanone is 247.20700. |
| Q: What is the InChIKey of 1-[2-[2-(5-nitrofuran-2-yl)ethenyl]imidazol-1-yl]ethanone? |
| A: InChIKey of 1-[2-[2-(5-nitrofuran-2-yl)ethenyl]imidazol-1-yl]ethanone is TVAGLKQFHLKALE-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 1-[2-[2-(5-nitrofuran-2-yl)ethenyl]imidazol-1-yl]ethanone? |
| A: Polar surface area (PSA) of 1-[2-[2-(5-nitrofuran-2-yl)ethenyl]imidazol-1-yl]ethanone is 93.85000. |
| Q: What is the SMILES notation of 1-[2-[2-(5-nitrofuran-2-yl)ethenyl]imidazol-1-yl]ethanone? |
| A: SMILES notation of 1-[2-[2-(5-nitrofuran-2-yl)ethenyl]imidazol-1-yl]ethanone is CC(=O)n1ccnc1C=Cc1ccc([N+](=O)[O-])o1. |
| Q: What is the molecular formula of 1-[2-[2-(5-nitrofuran-2-yl)ethenyl]imidazol-1-yl]ethanone? |
| A: Molecular formula of 1-[2-[2-(5-nitrofuran-2-yl)ethenyl]imidazol-1-yl]ethanone is C11H9N3O4. |
| Q: What are the upstream materials of 1-[2-[2-(5-nitrofuran-2-yl)ethenyl]imidazol-1-yl]ethanone? |
| A: Related upstream materials(CAS) of 1-[2-[2-(5-nitrofuran-2-yl)ethenyl]imidazol-1-yl]ethanone: 698-63-5;108-24-7. |
| Q: What is the English name of 1-[2-[2-(5-nitrofuran-2-yl)ethenyl]imidazol-1-yl]ethanone? |
| A: The English name of 1-[2-[2-(5-nitrofuran-2-yl)ethenyl]imidazol-1-yl]ethanone is 1-[2-[2-(5-nitrofuran-2-yl)ethenyl]imidazol-1-yl]ethanone. |